C18H27F3N4O3S — CID 155831927
N,N-dimethyl-9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecane-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155831927) has the molecular formula C18H27F3N4O3S and a molecular weight of 436.50 g/mol. Its IUPAC name is N,N-dimethyl-9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecane-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N,N-dimethyl-9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecane-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155831927 |
| Molecular Formula | C18H27F3N4O3S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | N,N-dimethyl-9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecane-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)N1CCC2(CCN(Cc3nccs3)CC2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H26N4OS.C2HF3O2/c1-18(2)15(21)20-10-5-16(6-11-20)3-8-19(9-4-16)13-14-17-7-12-22-14;3-2(4,5)1(6)7/h7,12H,3-6,8-11,13H2,1-2H3;(H,6,7) |
| InChIKey | CDHDSDJTGQAYBY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |