C20H23ClF3N3O3 — CID 155832513
(3aR,4R,6aS)-2-[(3-chlorophenyl)methyl]-2',3'-dimethylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,5'-imidazole]-4'-one;2,2,2-trifluoroacetic acid (PubChem CID 155832513) has the molecular formula C20H23ClF3N3O3 and a molecular weight of 445.87 g/mol. Its IUPAC name is (3aR,4R,6aS)-2-[(3-chlorophenyl)methyl]-2',3'-dimethylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,5'-imidazole]-4'-one;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,4R,6aS)-2-[(3-chlorophenyl)methyl]-2',3'-dimethylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,5'-imidazole]-4'-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155832513 |
| Molecular Formula | C20H23ClF3N3O3 |
| Molecular Weight | 445.87 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | (3aR,4R,6aS)-2-[(3-chlorophenyl)methyl]-2',3'-dimethylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,5'-imidazole]-4'-one;2,2,2-trifluoroacetic acid |
| SMILES | CC1=N[C@@]2(CC[C@@H]3CN(Cc4cccc(Cl)c4)C[C@@H]32)C(=O)N1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H22ClN3O.C2HF3O2/c1-12-20-18(17(23)21(12)2)7-6-14-10-22(11-16(14)18)9-13-4-3-5-15(19)8-13;3-2(4,5)1(6)7/h3-5,8,14,16H,6-7,9-11H2,1-2H3;(H,6,7)/t14-,16+,18-;/m1./s1 |
| InChIKey | TWGOLIZVCBMEDC-RLOSDUHESA-N |
| XLogP | 3.44 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.87 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |