C17H25F3N4O5 — CID 155833035
N-[(3S,3aR,7aR)-1-(2-methoxyethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1-methylpyrazole-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155833035) has the molecular formula C17H25F3N4O5 and a molecular weight of 422.40 g/mol. Its IUPAC name is N-[(3S,3aR,7aR)-1-(2-methoxyethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1-methylpyrazole-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(3S,3aR,7aR)-1-(2-methoxyethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1-methylpyrazole-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155833035 |
| Molecular Formula | C17H25F3N4O5 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N-[(3S,3aR,7aR)-1-(2-methoxyethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1-methylpyrazole-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCN1C[C@H](NC(=O)c2cnn(C)c2)[C@H]2OCCC[C@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H24N4O3.C2HF3O2/c1-18-9-11(8-16-18)15(20)17-12-10-19(5-7-21-2)13-4-3-6-22-14(12)13;3-2(4,5)1(6)7/h8-9,12-14H,3-7,10H2,1-2H3,(H,17,20);(H,6,7)/t12-,13+,14+;/m0./s1 |
| InChIKey | BMOMWUYYSHHHGG-SOIKFHLCSA-N |
| XLogP | 0.66 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |