C25H30F6N6O5S — CID 155833104
3-ethyl-13-pyrimidin-2-yl-9-(1,3-thiazol-2-ylmethyl)-3,9,13-triazadispiro[4.0.56.35]tetradecan-4-one;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155833104) has the molecular formula C25H30F6N6O5S and a molecular weight of 640.61 g/mol. Its IUPAC name is 3-ethyl-13-pyrimidin-2-yl-9-(1,3-thiazol-2-ylmethyl)-3,9,13-triazadispiro[4.0.56.35]tetradecan-4-one;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 3-ethyl-13-pyrimidin-2-yl-9-(1,3-thiazol-2-ylmethyl)-3,9,13-triazadispiro[4.0.56.35]tetradecan-4-one;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155833104 |
| Molecular Formula | C25H30F6N6O5S |
| Molecular Weight | 640.61 g/mol |
| Exact Mass | 640.19 |
| IUPAC Name | 3-ethyl-13-pyrimidin-2-yl-9-(1,3-thiazol-2-ylmethyl)-3,9,13-triazadispiro[4.0.56.35]tetradecan-4-one;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCN1CCC2(CN(c3ncccn3)CC23CCN(Cc2nccs2)CC3)C1=O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H28N6OS.2C2HF3O2/c1-2-26-12-6-21(18(26)28)16-27(19-23-7-3-8-24-19)15-20(21)4-10-25(11-5-20)14-17-22-9-13-29-17;2*3-2(4,5)1(6)7/h3,7-9,13H,2,4-6,10-12,14-16H2,1H3;2*(H,6,7) |
| InChIKey | DMMYXAXHTGPZGT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.61 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |