C16H22F3N3O3S — CID 155833245
(5S,10S)-10-ethyl-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.5]decan-2-one;2,2,2-trifluoroacetic acid (PubChem CID 155833245) has the molecular formula C16H22F3N3O3S and a molecular weight of 393.43 g/mol. Its IUPAC name is (5S,10S)-10-ethyl-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.5]decan-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | (5S,10S)-10-ethyl-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.5]decan-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155833245 |
| Molecular Formula | C16H22F3N3O3S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | (5S,10S)-10-ethyl-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.5]decan-2-one;2,2,2-trifluoroacetic acid |
| SMILES | CC[C@@H]1N(Cc2nccs2)CCC[C@]12CCC(=O)N2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H21N3OS.C2HF3O2/c1-2-11-14(6-4-12(18)16-14)5-3-8-17(11)10-13-15-7-9-19-13;3-2(4,5)1(6)7/h7,9,11H,2-6,8,10H2,1H3,(H,16,18);(H,6,7)/t11-,14-;/m0./s1 |
| InChIKey | HKUTTZZUERAVSE-XCBLFTOQSA-N |
| XLogP | 2.80 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |