C21H26F6N4O6S — CID 155833302
1-[2-(oxan-4-ylmethyl)-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl]-N-(1,3-thiazol-2-ylmethyl)methanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155833302) has the molecular formula C21H26F6N4O6S and a molecular weight of 576.52 g/mol. Its IUPAC name is 1-[2-(oxan-4-ylmethyl)-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl]-N-(1,3-thiazol-2-ylmethyl)methanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-[2-(oxan-4-ylmethyl)-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl]-N-(1,3-thiazol-2-ylmethyl)methanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155833302 |
| Molecular Formula | C21H26F6N4O6S |
| Molecular Weight | 576.52 g/mol |
| Exact Mass | 576.15 |
| IUPAC Name | 1-[2-(oxan-4-ylmethyl)-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl]-N-(1,3-thiazol-2-ylmethyl)methanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1csc(CNCC2OCCc3cn(CC4CCOCC4)nc32)n1 |
| InChI | InChI=1S/C17H24N4O2S.2C2HF3O2/c1-5-22-6-2-13(1)11-21-12-14-3-7-23-15(17(14)20-21)9-18-10-16-19-4-8-24-16;2*3-2(4,5)1(6)7/h4,8,12-13,15,18H,1-3,5-7,9-11H2;2*(H,6,7) |
| InChIKey | OAWZPEIDAJCNSD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 135.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |