C15H26F3N5O4S — CID 155833574
5-(diethylaminomethyl)-N,N-dimethyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-sulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155833574) has the molecular formula C15H26F3N5O4S and a molecular weight of 429.47 g/mol. Its IUPAC name is 5-(diethylaminomethyl)-N,N-dimethyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-sulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | 5-(diethylaminomethyl)-N,N-dimethyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-sulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155833574 |
| Molecular Formula | C15H26F3N5O4S |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 5-(diethylaminomethyl)-N,N-dimethyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-sulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CCN(CC)CC1CN(S(=O)(=O)N(C)C)Cc2cncn21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H25N5O2S.C2HF3O2/c1-5-16(6-2)8-13-10-17(21(19,20)15(3)4)9-12-7-14-11-18(12)13;3-2(4,5)1(6)7/h7,11,13H,5-6,8-10H2,1-4H3;(H,6,7) |
| InChIKey | NRFRKOMKHUQHES-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |