C13H20Cl2N2O2 — CID 155833667
(3aR,6aR)-3a-(pyridin-4-ylmethoxymethyl)-1,3,4,5,6,6a-hexahydrofuro[3,4-c]pyrrole;dihydrochloride (PubChem CID 155833667) has the molecular formula C13H20Cl2N2O2 and a molecular weight of 307.22 g/mol. Its IUPAC name is (3aR,6aR)-3a-(pyridin-4-ylmethoxymethyl)-1,3,4,5,6,6a-hexahydrofuro[3,4-c]pyrrole;dihydrochloride.
| Compound Name | (3aR,6aR)-3a-(pyridin-4-ylmethoxymethyl)-1,3,4,5,6,6a-hexahydrofuro[3,4-c]pyrrole;dihydrochloride |
|---|---|
| PubChem CID | 155833667 |
| Molecular Formula | C13H20Cl2N2O2 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (3aR,6aR)-3a-(pyridin-4-ylmethoxymethyl)-1,3,4,5,6,6a-hexahydrofuro[3,4-c]pyrrole;dihydrochloride |
| SMILES | Cl.Cl.c1cc(COC[C@@]23CNC[C@@H]2COC3)ccn1 |
| InChI | InChI=1S/C13H18N2O2.2ClH/c1-3-14-4-2-11(1)6-16-9-13-8-15-5-12(13)7-17-10-13;;/h1-4,12,15H,5-10H2;2*1H/t12-,13-;;/m1../s1 |
| InChIKey | VLYQBTDYZWONMN-SNFSYSBXSA-N |
| XLogP | 1.68 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |