C20H23F3N4O4S — CID 155833673
(3aR,5S,7aR)-1-pyrimidin-4-yl-N-(2-thiophen-2-ylethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155833673) has the molecular formula C20H23F3N4O4S and a molecular weight of 472.49 g/mol. Its IUPAC name is (3aR,5S,7aR)-1-pyrimidin-4-yl-N-(2-thiophen-2-ylethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,5S,7aR)-1-pyrimidin-4-yl-N-(2-thiophen-2-ylethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155833673 |
| Molecular Formula | C20H23F3N4O4S |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | (3aR,5S,7aR)-1-pyrimidin-4-yl-N-(2-thiophen-2-ylethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCCc1cccs1)[C@@H]1CC[C@@H]2[C@@H](CCN2c2ccncn2)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H22N4O2S.C2HF3O2/c23-18(20-9-5-13-2-1-11-25-13)16-4-3-14-15(24-16)7-10-22(14)17-6-8-19-12-21-17;3-2(4,5)1(6)7/h1-2,6,8,11-12,14-16H,3-5,7,9-10H2,(H,20,23);(H,6,7)/t14-,15-,16+;/m1./s1 |
| InChIKey | LHDGYVQCPKBULJ-IFKKJYDISA-N |
| XLogP | 2.66 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |