C23H22F3N3O4S — CID 155833710
(E)-1-[4-(pyridin-3-ylmethoxy)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]-3-thiophen-2-ylprop-2-en-1-one;2,2,2-trifluoroacetic acid (PubChem CID 155833710) has the molecular formula C23H22F3N3O4S and a molecular weight of 493.51 g/mol. Its IUPAC name is (E)-1-[4-(pyridin-3-ylmethoxy)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]-3-thiophen-2-ylprop-2-en-1-one;2,2,2-trifluoroacetic acid.
| Compound Name | (E)-1-[4-(pyridin-3-ylmethoxy)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]-3-thiophen-2-ylprop-2-en-1-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155833710 |
| Molecular Formula | C23H22F3N3O4S |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | (E)-1-[4-(pyridin-3-ylmethoxy)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]-3-thiophen-2-ylprop-2-en-1-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(/C=C/c1cccs1)N1Cc2cccn2CC(OCc2cccnc2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H21N3O2S.C2HF3O2/c25-21(8-7-20-6-3-11-27-20)24-13-18-5-2-10-23(18)14-19(15-24)26-16-17-4-1-9-22-12-17;3-2(4,5)1(6)7/h1-12,19H,13-16H2;(H,6,7)/b8-7+; |
| InChIKey | UJQKBLRNDKMGFO-USRGLUTNSA-N |
| XLogP | 4.22 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|