C20H29F3N2O5S — CID 155833921
(3aS,6aR)-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-3a-(oxan-4-ylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155833921) has the molecular formula C20H29F3N2O5S and a molecular weight of 466.52 g/mol. Its IUPAC name is (3aS,6aR)-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-3a-(oxan-4-ylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3aS,6aR)-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-3a-(oxan-4-ylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155833921 |
| Molecular Formula | C20H29F3N2O5S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | (3aS,6aR)-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-3a-(oxan-4-ylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2C[C@@H]3COC[C@]3(COCC3CCOCC3)C2)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H28N2O3S.C2HF3O2/c1-14-19-17(10-24-14)7-20-6-16-9-23-13-18(16,11-20)12-22-8-15-2-4-21-5-3-15;3-2(4,5)1(6)7/h10,15-16H,2-9,11-13H2,1H3;(H,6,7)/t16-,18-;/m1./s1 |
| InChIKey | XERGJMLRTNKGQV-PHJLCXHGSA-N |
| XLogP | 2.98 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |