C23H21F7N2O6S — CID 155834075
2-cyclobutyl-7-(6-fluoro-3-pyridinyl)-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrole 4,4-dioxide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155834075) has the molecular formula C23H21F7N2O6S and a molecular weight of 586.48 g/mol. Its IUPAC name is 2-cyclobutyl-7-(6-fluoro-3-pyridinyl)-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrole 4,4-dioxide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-cyclobutyl-7-(6-fluoro-3-pyridinyl)-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrole 4,4-dioxide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155834075 |
| Molecular Formula | C23H21F7N2O6S |
| Molecular Weight | 586.48 g/mol |
| Exact Mass | 586.10 |
| IUPAC Name | 2-cyclobutyl-7-(6-fluoro-3-pyridinyl)-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrole 4,4-dioxide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=S1(=O)c2ccc(-c3ccc(F)nc3)cc2C2CN(C3CCC3)CC21 |
| InChI | InChI=1S/C19H19FN2O2S.2C2HF3O2/c20-19-7-5-13(9-21-19)12-4-6-17-15(8-12)16-10-22(14-2-1-3-14)11-18(16)25(17,23)24;2*3-2(4,5)1(6)7/h4-9,14,16,18H,1-3,10-11H2;2*(H,6,7) |
| InChIKey | WVKASPARGNCWJD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|