C19H27F3N4O4 — CID 155834775
(3aS,4R,7aS)-N-cyclobutyl-6-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155834775) has the molecular formula C19H27F3N4O4 and a molecular weight of 432.44 g/mol. Its IUPAC name is (3aS,4R,7aS)-N-cyclobutyl-6-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aS,4R,7aS)-N-cyclobutyl-6-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155834775 |
| Molecular Formula | C19H27F3N4O4 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | (3aS,4R,7aS)-N-cyclobutyl-6-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cn1cc(CN2C[C@H](C(=O)NC3CCC3)[C@@H]3CCO[C@@H]3C2)cn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N4O2.C2HF3O2/c1-20-8-12(7-18-20)9-21-10-15(14-5-6-23-16(14)11-21)17(22)19-13-3-2-4-13;3-2(4,5)1(6)7/h7-8,13-16H,2-6,9-11H2,1H3,(H,19,22);(H,6,7)/t14-,15-,16+;/m0./s1 |
| InChIKey | PPXRCNCIRGHHHY-MLZPLGHASA-N |
| XLogP | 1.56 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |