C20H25F6N3O6S — CID 155834776
(3aS,4S,7aS)-N-cyclobutyl-6-(1,3-thiazol-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155834776) has the molecular formula C20H25F6N3O6S and a molecular weight of 549.49 g/mol. Its IUPAC name is (3aS,4S,7aS)-N-cyclobutyl-6-(1,3-thiazol-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aS,4S,7aS)-N-cyclobutyl-6-(1,3-thiazol-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155834776 |
| Molecular Formula | C20H25F6N3O6S |
| Molecular Weight | 549.49 g/mol |
| Exact Mass | 549.14 |
| IUPAC Name | (3aS,4S,7aS)-N-cyclobutyl-6-(1,3-thiazol-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(NC1CCC1)[C@@H]1CN(Cc2nccs2)C[C@H]2OCC[C@H]21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H23N3O2S.2C2HF3O2/c20-16(18-11-2-1-3-11)13-8-19(10-15-17-5-7-22-15)9-14-12(13)4-6-21-14;2*3-2(4,5)1(6)7/h5,7,11-14H,1-4,6,8-10H2,(H,18,20);2*(H,6,7)/t12-,13+,14+;;/m0../s1 |
| InChIKey | MINBIPRGGJSXRT-BCIMQBNMSA-N |
| XLogP | 2.92 |
| TPSA | 129.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |