C18H25F3N2O4S — CID 155834956
(3aR,5R,7aR)-5-(cyclopropylmethoxymethyl)-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155834956) has the molecular formula C18H25F3N2O4S and a molecular weight of 422.47 g/mol. Its IUPAC name is (3aR,5R,7aR)-5-(cyclopropylmethoxymethyl)-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,5R,7aR)-5-(cyclopropylmethoxymethyl)-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155834956 |
| Molecular Formula | C18H25F3N2O4S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | (3aR,5R,7aR)-5-(cyclopropylmethoxymethyl)-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1csc(CN2CC[C@H]3O[C@@H](COCC4CC4)CC[C@H]32)n1 |
| InChI | InChI=1S/C16H24N2O2S.C2HF3O2/c1-2-12(1)10-19-11-13-3-4-14-15(20-13)5-7-18(14)9-16-17-6-8-21-16;3-2(4,5)1(6)7/h6,8,12-15H,1-5,7,9-11H2;(H,6,7)/t13-,14-,15-;/m1./s1 |
| InChIKey | TTYABAXZUNFOFR-RFMLDLTKSA-N |
| XLogP | 3.32 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |