C18H22F3N3O4S2 — CID 155835109
(3R,3aS,7aR)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155835109) has the molecular formula C18H22F3N3O4S2 and a molecular weight of 465.52 g/mol. Its IUPAC name is (3R,3aS,7aR)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,3aS,7aR)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155835109 |
| Molecular Formula | C18H22F3N3O4S2 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | (3R,3aS,7aR)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CO[C@@H]2CN(Cc3nccs3)[C@@H]3CCCO[C@@H]32)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H21N3O2S2.C2HF3O2/c1-11-18-12(10-23-11)9-21-14-7-19(8-15-17-4-6-22-15)13-3-2-5-20-16(13)14;3-2(4,5)1(6)7/h4,6,10,13-14,16H,2-3,5,7-9H2,1H3;(H,6,7)/t13-,14-,16+;/m1./s1 |
| InChIKey | LJRIGFHMTSKVHN-ISNMTSCSSA-N |
| XLogP | 3.49 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |