C23H29F5N4O4 — CID 155835121
2-[(2,5-dimethylpyrazol-3-yl)methyl]-10,10-difluoro-8-[(2-methylfuran-3-yl)methyl]-2,8-diazaspiro[5.5]undecan-1-one;2,2,2-trifluoroacetic acid (PubChem CID 155835121) has the molecular formula C23H29F5N4O4 and a molecular weight of 520.50 g/mol. Its IUPAC name is 2-[(2,5-dimethylpyrazol-3-yl)methyl]-10,10-difluoro-8-[(2-methylfuran-3-yl)methyl]-2,8-diazaspiro[5.5]undecan-1-one;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(2,5-dimethylpyrazol-3-yl)methyl]-10,10-difluoro-8-[(2-methylfuran-3-yl)methyl]-2,8-diazaspiro[5.5]undecan-1-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155835121 |
| Molecular Formula | C23H29F5N4O4 |
| Molecular Weight | 520.50 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 2-[(2,5-dimethylpyrazol-3-yl)methyl]-10,10-difluoro-8-[(2-methylfuran-3-yl)methyl]-2,8-diazaspiro[5.5]undecan-1-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(CN2CCCC3(CN(Cc4ccoc4C)CC(F)(F)C3)C2=O)n(C)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H28F2N4O2.C2HF3O2/c1-15-9-18(25(3)24-15)11-27-7-4-6-20(19(27)28)12-21(22,23)14-26(13-20)10-17-5-8-29-16(17)2;3-2(4,5)1(6)7/h5,8-9H,4,6-7,10-14H2,1-3H3;(H,6,7) |
| InChIKey | XFLBJVIDRJVPHM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |