C20H29F3N4O6 — CID 155835189
1'-(2-methoxyacetyl)-N-(2-methylpropyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155835189) has the molecular formula C20H29F3N4O6 and a molecular weight of 478.47 g/mol. Its IUPAC name is 1'-(2-methoxyacetyl)-N-(2-methylpropyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1'-(2-methoxyacetyl)-N-(2-methylpropyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155835189 |
| Molecular Formula | C20H29F3N4O6 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 1'-(2-methoxyacetyl)-N-(2-methylpropyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COCC(=O)N1CCC2(CC1)OC(C(=O)NCC(C)C)Cn1ccnc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H28N4O4.C2HF3O2/c1-13(2)10-20-16(24)14-11-22-9-6-19-17(22)18(26-14)4-7-21(8-5-18)15(23)12-25-3;3-2(4,5)1(6)7/h6,9,13-14H,4-5,7-8,10-12H2,1-3H3,(H,20,24);(H,6,7) |
| InChIKey | MGIPPLCWVSLGBK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |