C20H27F3N2O4S — CID 155835280
[(3R,3aS,7aS)-3-(pyrrolidin-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-(3-methylthiophen-2-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155835280) has the molecular formula C20H27F3N2O4S and a molecular weight of 448.51 g/mol. Its IUPAC name is [(3R,3aS,7aS)-3-(pyrrolidin-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-(3-methylthiophen-2-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3R,3aS,7aS)-3-(pyrrolidin-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-(3-methylthiophen-2-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155835280 |
| Molecular Formula | C20H27F3N2O4S |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | [(3R,3aS,7aS)-3-(pyrrolidin-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-(3-methylthiophen-2-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccsc1C(=O)N1CC[C@@H]2CO[C@@H](CN3CCCC3)[C@@H]2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H26N2O2S.C2HF3O2/c1-13-5-9-23-17(13)18(21)20-8-4-14-12-22-16(15(14)10-20)11-19-6-2-3-7-19;3-2(4,5)1(6)7/h5,9,14-16H,2-4,6-8,10-12H2,1H3;(H,6,7)/t14-,15-,16+;/m1./s1 |
| InChIKey | NTVJARQKTWWEMJ-IFKKJYDISA-N |
| XLogP | 3.26 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |