C22H32F6N4O7 — CID 155835329
2-[[6-(6-methoxypyrimidin-4-yl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-4a-yl]methoxy]-N,N-dimethylethanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155835329) has the molecular formula C22H32F6N4O7 and a molecular weight of 578.51 g/mol. Its IUPAC name is 2-[[6-(6-methoxypyrimidin-4-yl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-4a-yl]methoxy]-N,N-dimethylethanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[[6-(6-methoxypyrimidin-4-yl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-4a-yl]methoxy]-N,N-dimethylethanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155835329 |
| Molecular Formula | C22H32F6N4O7 |
| Molecular Weight | 578.51 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | 2-[[6-(6-methoxypyrimidin-4-yl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-4a-yl]methoxy]-N,N-dimethylethanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COc1cc(N2CCC3OCCCC3(COCCN(C)C)C2)ncn1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H30N4O3.2C2HF3O2/c1-21(2)8-10-24-13-18-6-4-9-25-15(18)5-7-22(12-18)16-11-17(23-3)20-14-19-16;2*3-2(4,5)1(6)7/h11,14-15H,4-10,12-13H2,1-3H3;2*(H,6,7) |
| InChIKey | GUKBJUXXBKBJDF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|