C20H23F3N4O5 — CID 155835364
[(4R,4aS,7aS)-6-(furan-2-ylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-pyrazin-2-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155835364) has the molecular formula C20H23F3N4O5 and a molecular weight of 456.42 g/mol. Its IUPAC name is [(4R,4aS,7aS)-6-(furan-2-ylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-pyrazin-2-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(4R,4aS,7aS)-6-(furan-2-ylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-pyrazin-2-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155835364 |
| Molecular Formula | C20H23F3N4O5 |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | [(4R,4aS,7aS)-6-(furan-2-ylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-pyrazin-2-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | CO[C@@H]1CCN(C(=O)c2cnccn2)[C@@H]2CN(Cc3ccco3)C[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H22N4O3.C2HF3O2/c1-24-17-4-7-22(18(23)15-9-19-5-6-20-15)16-12-21(11-14(16)17)10-13-3-2-8-25-13;3-2(4,5)1(6)7/h2-3,5-6,8-9,14,16-17H,4,7,10-12H2,1H3;(H,6,7)/t14-,16+,17+;/m0./s1 |
| InChIKey | GTVJEPMXNGNNKM-DYWKTHLTSA-N |
| XLogP | 2.06 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |