C20H29F3N2O5S — CID 155835450
(3aR,5R,7aR)-5-(oxan-4-ylmethoxymethyl)-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155835450) has the molecular formula C20H29F3N2O5S and a molecular weight of 466.52 g/mol. Its IUPAC name is (3aR,5R,7aR)-5-(oxan-4-ylmethoxymethyl)-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,5R,7aR)-5-(oxan-4-ylmethoxymethyl)-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155835450 |
| Molecular Formula | C20H29F3N2O5S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | (3aR,5R,7aR)-5-(oxan-4-ylmethoxymethyl)-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1csc(CN2CC[C@H]3O[C@@H](COCC4CCOCC4)CC[C@H]32)n1 |
| InChI | InChI=1S/C18H28N2O3S.C2HF3O2/c1-2-16-17(3-7-20(16)11-18-19-6-10-24-18)23-15(1)13-22-12-14-4-8-21-9-5-14;3-2(4,5)1(6)7/h6,10,14-17H,1-5,7-9,11-13H2;(H,6,7)/t15-,16-,17-;/m1./s1 |
| InChIKey | NTUUOMWZFKIJES-UATJXVQHSA-N |
| XLogP | 3.34 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |