C22H27F3N6O3 — CID 155835828
2-(cyclohexen-1-yl)-1-[7-[(pyrimidin-2-ylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]ethanone;2,2,2-trifluoroacetic acid (PubChem CID 155835828) has the molecular formula C22H27F3N6O3 and a molecular weight of 480.49 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-1-[7-[(pyrimidin-2-ylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]ethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(cyclohexen-1-yl)-1-[7-[(pyrimidin-2-ylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]ethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155835828 |
| Molecular Formula | C22H27F3N6O3 |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 2-(cyclohexen-1-yl)-1-[7-[(pyrimidin-2-ylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]ethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(CC1=CCCCC1)N1Cc2ccnn2CC(CNc2ncccn2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H26N6O.C2HF3O2/c27-19(11-16-5-2-1-3-6-16)25-13-17(12-23-20-21-8-4-9-22-20)14-26-18(15-25)7-10-24-26;3-2(4,5)1(6)7/h4-5,7-10,17H,1-3,6,11-15H2,(H,21,22,23);(H,6,7) |
| InChIKey | QDESKAJBWGMERL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|