C19H27F6N5O5 — CID 155836453
(2S,3aR,7aS)-1-methyl-5-(oxolan-3-yl)-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155836453) has the molecular formula C19H27F6N5O5 and a molecular weight of 519.44 g/mol. Its IUPAC name is (2S,3aR,7aS)-1-methyl-5-(oxolan-3-yl)-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (2S,3aR,7aS)-1-methyl-5-(oxolan-3-yl)-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155836453 |
| Molecular Formula | C19H27F6N5O5 |
| Molecular Weight | 519.44 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | (2S,3aR,7aS)-1-methyl-5-(oxolan-3-yl)-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN1[C@H](Cn2cncn2)C[C@@H]2CN(C3CCOC3)CC[C@@H]21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H25N5O.2C2HF3O2/c1-18-14(8-20-11-16-10-17-20)6-12-7-19(4-2-15(12)18)13-3-5-21-9-13;2*3-2(4,5)1(6)7/h10-15H,2-9H2,1H3;2*(H,6,7)/t12-,13?,14+,15+;;/m1../s1 |
| InChIKey | UNVQNIIJLYBBCV-OQFMUGKZSA-N |
| XLogP | 1.73 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |