C23H24F3N3O4S — CID 155836482
3-(3-methoxyphenyl)-1'-(thiophen-2-ylmethyl)spiro[5,8-dihydroimidazo[2,1-c][1,4]oxazine-6,3'-pyrrolidine];2,2,2-trifluoroacetic acid (PubChem CID 155836482) has the molecular formula C23H24F3N3O4S and a molecular weight of 495.52 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-1'-(thiophen-2-ylmethyl)spiro[5,8-dihydroimidazo[2,1-c][1,4]oxazine-6,3'-pyrrolidine];2,2,2-trifluoroacetic acid.
| Compound Name | 3-(3-methoxyphenyl)-1'-(thiophen-2-ylmethyl)spiro[5,8-dihydroimidazo[2,1-c][1,4]oxazine-6,3'-pyrrolidine];2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155836482 |
| Molecular Formula | C23H24F3N3O4S |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 3-(3-methoxyphenyl)-1'-(thiophen-2-ylmethyl)spiro[5,8-dihydroimidazo[2,1-c][1,4]oxazine-6,3'-pyrrolidine];2,2,2-trifluoroacetic acid |
| SMILES | COc1cccc(-c2cnc3n2CC2(CCN(Cc4cccs4)C2)OC3)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H23N3O2S.C2HF3O2/c1-25-17-5-2-4-16(10-17)19-11-22-20-13-26-21(15-24(19)20)7-8-23(14-21)12-18-6-3-9-27-18;3-2(4,5)1(6)7/h2-6,9-11H,7-8,12-15H2,1H3;(H,6,7) |
| InChIKey | NIBSOAMEHRKRBQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |