C14H18F3N3O4S — CID 155836540
(3R,3aS,6aS)-N-methyl-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155836540) has the molecular formula C14H18F3N3O4S and a molecular weight of 381.38 g/mol. Its IUPAC name is (3R,3aS,6aS)-N-methyl-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,3aS,6aS)-N-methyl-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155836540 |
| Molecular Formula | C14H18F3N3O4S |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | (3R,3aS,6aS)-N-methyl-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CNC(=O)[C@H]1CO[C@@H]2CN(Cc3nccs3)C[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H17N3O2S.C2HF3O2/c1-13-12(16)9-7-17-10-5-15(4-8(9)10)6-11-14-2-3-18-11;3-2(4,5)1(6)7/h2-3,8-10H,4-7H2,1H3,(H,13,16);(H,6,7)/t8-,9+,10-;/m1./s1 |
| InChIKey | GAGWFPCUXRWZQP-YMQJAAJZSA-N |
| XLogP | 0.97 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |