C19H22F3N3O3S2 — CID 155837011
(3aR,7aR)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1-(thiophen-2-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid (PubChem CID 155837011) has the molecular formula C19H22F3N3O3S2 and a molecular weight of 461.53 g/mol. Its IUPAC name is (3aR,7aR)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1-(thiophen-2-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,7aR)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1-(thiophen-2-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155837011 |
| Molecular Formula | C19H22F3N3O3S2 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | (3aR,7aR)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1-(thiophen-2-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2C(=O)CC[C@@H]3[C@H]2CCN3Cc2cccs2)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H21N3OS2.C2HF3O2/c1-12-18-13(11-23-12)9-20-16-6-7-19(10-14-3-2-8-22-14)15(16)4-5-17(20)21;3-2(4,5)1(6)7/h2-3,8,11,15-16H,4-7,9-10H2,1H3;(H,6,7)/t15-,16-;/m1./s1 |
| InChIKey | WIOWSQZZAMZJFY-QNBGGDODSA-N |
| XLogP | 3.91 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |