C16H23F3N2O4 — CID 155837038
cyclopent-3-en-1-yl(1-oxa-4,8-diazaspiro[5.5]undecan-4-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155837038) has the molecular formula C16H23F3N2O4 and a molecular weight of 364.36 g/mol. Its IUPAC name is cyclopent-3-en-1-yl(1-oxa-4,8-diazaspiro[5.5]undecan-4-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | cyclopent-3-en-1-yl(1-oxa-4,8-diazaspiro[5.5]undecan-4-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155837038 |
| Molecular Formula | C16H23F3N2O4 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | cyclopent-3-en-1-yl(1-oxa-4,8-diazaspiro[5.5]undecan-4-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(C1CC=CC1)N1CCOC2(CCCNC2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H22N2O2.C2HF3O2/c17-13(12-4-1-2-5-12)16-8-9-18-14(11-16)6-3-7-15-10-14;3-2(4,5)1(6)7/h1-2,12,15H,3-11H2;(H,6,7) |
| InChIKey | XAUQTUPIAUWVNX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|