C19H26F3N3O4S — CID 155837092
1-[(4aS,8R,8aS)-6-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]pyrrolidin-2-one;2,2,2-trifluoroacetic acid (PubChem CID 155837092) has the molecular formula C19H26F3N3O4S and a molecular weight of 449.50 g/mol. Its IUPAC name is 1-[(4aS,8R,8aS)-6-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]pyrrolidin-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(4aS,8R,8aS)-6-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]pyrrolidin-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155837092 |
| Molecular Formula | C19H26F3N3O4S |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 1-[(4aS,8R,8aS)-6-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]pyrrolidin-2-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ncsc1CN1C[C@@H]2CCCO[C@@H]2[C@H](N2CCCC2=O)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25N3O2S.C2HF3O2/c1-12-15(23-11-18-12)10-19-8-13-4-3-7-22-17(13)14(9-19)20-6-2-5-16(20)21;3-2(4,5)1(6)7/h11,13-14,17H,2-10H2,1H3;(H,6,7)/t13-,14+,17-;/m0./s1 |
| InChIKey | ITZMOSHAXMGKLW-ZTCLJSFKSA-N |
| XLogP | 2.69 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |