C21H35F3N2O6 — CID 155837182
N,N-dimethyl-2-[[6-(oxan-4-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-4a-yl]methoxy]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 155837182) has the molecular formula C21H35F3N2O6 and a molecular weight of 468.51 g/mol. Its IUPAC name is N,N-dimethyl-2-[[6-(oxan-4-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-4a-yl]methoxy]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N,N-dimethyl-2-[[6-(oxan-4-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-4a-yl]methoxy]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155837182 |
| Molecular Formula | C21H35F3N2O6 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | N,N-dimethyl-2-[[6-(oxan-4-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-4a-yl]methoxy]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)COCC12CCCOC1CCN(CC1CCOCC1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H34N2O4.C2HF3O2/c1-20(2)18(22)13-24-15-19-7-3-9-25-17(19)4-8-21(14-19)12-16-5-10-23-11-6-16;3-2(4,5)1(6)7/h16-17H,3-15H2,1-2H3;(H,6,7) |
| InChIKey | NBPAWDOXDTTYJX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |