C19H27F3N2O4S — CID 155837202
6-[(2-methyl-1,3-thiazol-4-yl)methyl]-4a-(prop-2-enoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 155837202) has the molecular formula C19H27F3N2O4S and a molecular weight of 436.50 g/mol. Its IUPAC name is 6-[(2-methyl-1,3-thiazol-4-yl)methyl]-4a-(prop-2-enoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | 6-[(2-methyl-1,3-thiazol-4-yl)methyl]-4a-(prop-2-enoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155837202 |
| Molecular Formula | C19H27F3N2O4S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 6-[(2-methyl-1,3-thiazol-4-yl)methyl]-4a-(prop-2-enoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | C=CCOCC12CCCOC1CCN(Cc1csc(C)n1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N2O2S.C2HF3O2/c1-3-8-20-13-17-6-4-9-21-16(17)5-7-19(12-17)10-15-11-22-14(2)18-15;3-2(4,5)1(6)7/h3,11,16H,1,4-10,12-13H2,2H3;(H,6,7) |
| InChIKey | DYUKRMGELMUAER-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|