C18H25F3N2O4S — CID 155837429
(4aS,7R,7aR)-4-cyclobutyl-7-[(2-methyl-1,3-thiazol-4-yl)methoxy]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid (PubChem CID 155837429) has the molecular formula C18H25F3N2O4S and a molecular weight of 422.47 g/mol. Its IUPAC name is (4aS,7R,7aR)-4-cyclobutyl-7-[(2-methyl-1,3-thiazol-4-yl)methoxy]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid.
| Compound Name | (4aS,7R,7aR)-4-cyclobutyl-7-[(2-methyl-1,3-thiazol-4-yl)methoxy]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155837429 |
| Molecular Formula | C18H25F3N2O4S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | (4aS,7R,7aR)-4-cyclobutyl-7-[(2-methyl-1,3-thiazol-4-yl)methoxy]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CO[C@@H]2CC[C@H]3[C@H]2OCCN3C2CCC2)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N2O2S.C2HF3O2/c1-11-17-12(10-21-11)9-20-15-6-5-14-16(15)19-8-7-18(14)13-3-2-4-13;3-2(4,5)1(6)7/h10,13-16H,2-9H2,1H3;(H,6,7)/t14-,15+,16+;/m0./s1 |
| InChIKey | IMUWHUTWXGJJRB-FUQNERGOSA-N |
| XLogP | 3.39 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |