C23H33F3N4O5 — CID 155837639
3-ethyl-9-(furan-2-ylmethyl)-N,N-dimethyl-4-oxo-3,9,13-triazadispiro[4.0.56.35]tetradecane-13-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155837639) has the molecular formula C23H33F3N4O5 and a molecular weight of 502.53 g/mol. Its IUPAC name is 3-ethyl-9-(furan-2-ylmethyl)-N,N-dimethyl-4-oxo-3,9,13-triazadispiro[4.0.56.35]tetradecane-13-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-ethyl-9-(furan-2-ylmethyl)-N,N-dimethyl-4-oxo-3,9,13-triazadispiro[4.0.56.35]tetradecane-13-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155837639 |
| Molecular Formula | C23H33F3N4O5 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 3-ethyl-9-(furan-2-ylmethyl)-N,N-dimethyl-4-oxo-3,9,13-triazadispiro[4.0.56.35]tetradecane-13-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCN1CCC2(CN(C(=O)N(C)C)CC23CCN(Cc2ccco2)CC3)C1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H32N4O3.C2HF3O2/c1-4-24-12-9-21(18(24)26)16-25(19(27)22(2)3)15-20(21)7-10-23(11-8-20)14-17-6-5-13-28-17;3-2(4,5)1(6)7/h5-6,13H,4,7-12,14-16H2,1-3H3;(H,6,7) |
| InChIKey | WZQUNFPCGSNXSI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |