C19H28F3N3O5S — CID 155837747
2-[(1S,3aR,7aR)-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N-(2-methoxyethyl)acetamide;2,2,2-trifluoroacetic acid (PubChem CID 155837747) has the molecular formula C19H28F3N3O5S and a molecular weight of 467.51 g/mol. Its IUPAC name is 2-[(1S,3aR,7aR)-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N-(2-methoxyethyl)acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(1S,3aR,7aR)-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N-(2-methoxyethyl)acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155837747 |
| Molecular Formula | C19H28F3N3O5S |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 2-[(1S,3aR,7aR)-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N-(2-methoxyethyl)acetamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCNC(=O)C[C@@H]1OC[C@H]2CN(Cc3nc(C)cs3)CC[C@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H27N3O3S.C2HF3O2/c1-12-11-24-17(19-12)9-20-5-3-14-13(8-20)10-23-15(14)7-16(21)18-4-6-22-2;3-2(4,5)1(6)7/h11,13-15H,3-10H2,1-2H3,(H,18,21);(H,6,7)/t13-,14-,15+;/m1./s1 |
| InChIKey | QJXDCAKFZIJBLI-QRWISWEOSA-N |
| XLogP | 2.07 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|