C21H24F3N5O3S — CID 155837905
3-(1-propan-2-ylpyrrolidin-3-yl)-N-(thiophen-2-ylmethyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155837905) has the molecular formula C21H24F3N5O3S and a molecular weight of 483.52 g/mol. Its IUPAC name is 3-(1-propan-2-ylpyrrolidin-3-yl)-N-(thiophen-2-ylmethyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(1-propan-2-ylpyrrolidin-3-yl)-N-(thiophen-2-ylmethyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155837905 |
| Molecular Formula | C21H24F3N5O3S |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 3-(1-propan-2-ylpyrrolidin-3-yl)-N-(thiophen-2-ylmethyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)N1CCC(c2nnc3ccc(C(=O)NCc4cccs4)cn23)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H23N5OS.C2HF3O2/c1-13(2)23-8-7-14(11-23)18-22-21-17-6-5-15(12-24(17)18)19(25)20-10-16-4-3-9-26-16;3-2(4,5)1(6)7/h3-6,9,12-14H,7-8,10-11H2,1-2H3,(H,20,25);(H,6,7) |
| InChIKey | PPRMMYPNACZYIP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 99.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |