C17H23F3N2O4S — CID 155837946
(3S,3aR,6aS)-1-(cyclopropylmethyl)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155837946) has the molecular formula C17H23F3N2O4S and a molecular weight of 408.44 g/mol. Its IUPAC name is (3S,3aR,6aS)-1-(cyclopropylmethyl)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3S,3aR,6aS)-1-(cyclopropylmethyl)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155837946 |
| Molecular Formula | C17H23F3N2O4S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (3S,3aR,6aS)-1-(cyclopropylmethyl)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CO[C@@H]2CN(CC3CC3)[C@@H]3COC[C@@H]32)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H22N2O2S.C2HF3O2/c1-10-16-12(9-20-10)6-19-15-5-17(4-11-2-3-11)14-8-18-7-13(14)15;3-2(4,5)1(6)7/h9,11,13-15H,2-8H2,1H3;(H,6,7)/t13-,14+,15+;/m0./s1 |
| InChIKey | WACMTXSGZQBXRW-ONAKXNSWSA-N |
| XLogP | 2.71 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |