C20H28F6N6O5S — CID 155838206
2-[[1-ethyl-5-(1,3-thiazol-2-ylmethyl)-6,7-dihydro-4H-triazolo[4,5-c]pyridin-7-yl]methoxy]-N,N-dimethylethanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155838206) has the molecular formula C20H28F6N6O5S and a molecular weight of 578.54 g/mol. Its IUPAC name is 2-[[1-ethyl-5-(1,3-thiazol-2-ylmethyl)-6,7-dihydro-4H-triazolo[4,5-c]pyridin-7-yl]methoxy]-N,N-dimethylethanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[[1-ethyl-5-(1,3-thiazol-2-ylmethyl)-6,7-dihydro-4H-triazolo[4,5-c]pyridin-7-yl]methoxy]-N,N-dimethylethanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155838206 |
| Molecular Formula | C20H28F6N6O5S |
| Molecular Weight | 578.54 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | 2-[[1-ethyl-5-(1,3-thiazol-2-ylmethyl)-6,7-dihydro-4H-triazolo[4,5-c]pyridin-7-yl]methoxy]-N,N-dimethylethanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCn1nnc2c1C(COCCN(C)C)CN(Cc1nccs1)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H26N6OS.2C2HF3O2/c1-4-22-16-13(12-23-7-6-20(2)3)9-21(10-14(16)18-19-22)11-15-17-5-8-24-15;2*3-2(4,5)1(6)7/h5,8,13H,4,6-7,9-12H2,1-3H3;2*(H,6,7) |
| InChIKey | ULYKSMKCKGJPJC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.54 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|