C17H21F7N4O5 — CID 155838302
1-[(3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]-N,N-dimethylmethanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155838302) has the molecular formula C17H21F7N4O5 and a molecular weight of 494.36 g/mol. Its IUPAC name is 1-[(3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]-N,N-dimethylmethanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-[(3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]-N,N-dimethylmethanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155838302 |
| Molecular Formula | C17H21F7N4O5 |
| Molecular Weight | 494.36 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 1-[(3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]-N,N-dimethylmethanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)C[C@]12COC[C@H]1CN(c1ncc(F)cn1)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H19FN4O.2C2HF3O2/c1-17(2)7-13-8-18(5-10(13)6-19-9-13)12-15-3-11(14)4-16-12;2*3-2(4,5)1(6)7/h3-4,10H,5-9H2,1-2H3;2*(H,6,7)/t10-,13+;;/m1../s1 |
| InChIKey | OKZJSUQGELAJBI-SRSVFUAYSA-N |
| XLogP | 1.90 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |