C19H25F3N2O5S — CID 155838388
(1S,11S)-10-(cyclopropylmethyl)-14-methyl-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide;2,2,2-trifluoroacetic acid (PubChem CID 155838388) has the molecular formula C19H25F3N2O5S and a molecular weight of 450.48 g/mol. Its IUPAC name is (1S,11S)-10-(cyclopropylmethyl)-14-methyl-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide;2,2,2-trifluoroacetic acid.
| Compound Name | (1S,11S)-10-(cyclopropylmethyl)-14-methyl-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155838388 |
| Molecular Formula | C19H25F3N2O5S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | (1S,11S)-10-(cyclopropylmethyl)-14-methyl-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide;2,2,2-trifluoroacetic acid |
| SMILES | CN1CC[C@@H]2Oc3ccccc3S(=O)(=O)N(CC3CC3)[C@H]2CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N2O3S.C2HF3O2/c1-18-10-8-14-15(9-11-18)22-16-4-2-3-5-17(16)23(20,21)19(14)12-13-6-7-13;3-2(4,5)1(6)7/h2-5,13-15H,6-12H2,1H3;(H,6,7)/t14-,15-;/m0./s1 |
| InChIKey | GDQYMXVGKGVRDP-YYLIZZNMSA-N |
| XLogP | 2.58 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |