C26H32F3N3O4S — CID 155838931
2-[1'-[(2-methyl-1,3-thiazol-4-yl)methyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]-1-morpholin-4-ylethanone;2,2,2-trifluoroacetic acid (PubChem CID 155838931) has the molecular formula C26H32F3N3O4S and a molecular weight of 539.62 g/mol. Its IUPAC name is 2-[1'-[(2-methyl-1,3-thiazol-4-yl)methyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]-1-morpholin-4-ylethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[1'-[(2-methyl-1,3-thiazol-4-yl)methyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]-1-morpholin-4-ylethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155838931 |
| Molecular Formula | C26H32F3N3O4S |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | 2-[1'-[(2-methyl-1,3-thiazol-4-yl)methyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]-1-morpholin-4-ylethanone;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2CCC3(CC2)CC(CC(=O)N2CCOCC2)c2ccccc23)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H31N3O2S.C2HF3O2/c1-18-25-20(17-30-18)16-26-8-6-24(7-9-26)15-19(21-4-2-3-5-22(21)24)14-23(28)27-10-12-29-13-11-27;3-2(4,5)1(6)7/h2-5,17,19H,6-16H2,1H3;(H,6,7) |
| InChIKey | HCRVPEYCPXOJAJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |