C19H30F3N5O4 — CID 155839025
[3-(diethylaminomethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-7-yl]-morpholin-4-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155839025) has the molecular formula C19H30F3N5O4 and a molecular weight of 449.47 g/mol. Its IUPAC name is [3-(diethylaminomethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-7-yl]-morpholin-4-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [3-(diethylaminomethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-7-yl]-morpholin-4-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155839025 |
| Molecular Formula | C19H30F3N5O4 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | [3-(diethylaminomethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-7-yl]-morpholin-4-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | CCN(CC)Cc1cnc2n1CCN(C(=O)N1CCOCC1)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H29N5O2.C2HF3O2/c1-3-19(4-2)14-15-13-18-16-5-6-20(7-8-22(15)16)17(23)21-9-11-24-12-10-21;3-2(4,5)1(6)7/h13H,3-12,14H2,1-2H3;(H,6,7) |
| InChIKey | KPJJMAMUYIDOJH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |