C15H20F3N3O6S — CID 155839139
(3R,3aR,6aS)-1-(1-methylimidazol-4-yl)sulfonyl-3-prop-2-enoxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155839139) has the molecular formula C15H20F3N3O6S and a molecular weight of 427.40 g/mol. Its IUPAC name is (3R,3aR,6aS)-1-(1-methylimidazol-4-yl)sulfonyl-3-prop-2-enoxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,3aR,6aS)-1-(1-methylimidazol-4-yl)sulfonyl-3-prop-2-enoxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155839139 |
| Molecular Formula | C15H20F3N3O6S |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | (3R,3aR,6aS)-1-(1-methylimidazol-4-yl)sulfonyl-3-prop-2-enoxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | C=CCO[C@H]1CN(S(=O)(=O)c2cn(C)cn2)[C@@H]2COC[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H19N3O4S.C2HF3O2/c1-3-4-20-12-5-16(11-8-19-7-10(11)12)21(17,18)13-6-15(2)9-14-13;3-2(4,5)1(6)7/h3,6,9-12H,1,4-5,7-8H2,2H3;(H,6,7)/t10-,11+,12-;/m0./s1 |
| InChIKey | RPMXSLBVGPMVBH-XNGOQOFYSA-N |
| XLogP | 0.64 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|