C16H21F6N3O6S2 — CID 155839163
4-[[(3aS,6aR)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]-2-methyl-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155839163) has the molecular formula C16H21F6N3O6S2 and a molecular weight of 529.48 g/mol. Its IUPAC name is 4-[[(3aS,6aR)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]-2-methyl-1,3-thiazole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[[(3aS,6aR)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]-2-methyl-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155839163 |
| Molecular Formula | C16H21F6N3O6S2 |
| Molecular Weight | 529.48 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | 4-[[(3aS,6aR)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]-2-methyl-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1nc(CN2CC[C@H]3[C@H]2CCN3S(C)(=O)=O)cs1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H19N3O2S2.2C2HF3O2/c1-9-13-10(8-18-9)7-14-5-3-12-11(14)4-6-15(12)19(2,16)17;2*3-2(4,5)1(6)7/h8,11-12H,3-7H2,1-2H3;2*(H,6,7)/t11-,12+;;/m1../s1 |
| InChIKey | SNTCXZZTKWUKRB-QBKBNCOFSA-N |
| XLogP | 2.33 |
| TPSA | 128.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |