C16H22F3N5O4S2 — CID 155839183
N-[2-[7-[(4-methyl-1,3-thiazol-5-yl)methyl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-5-yl]ethyl]methanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155839183) has the molecular formula C16H22F3N5O4S2 and a molecular weight of 469.51 g/mol. Its IUPAC name is N-[2-[7-[(4-methyl-1,3-thiazol-5-yl)methyl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-5-yl]ethyl]methanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-[7-[(4-methyl-1,3-thiazol-5-yl)methyl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-5-yl]ethyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155839183 |
| Molecular Formula | C16H22F3N5O4S2 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | N-[2-[7-[(4-methyl-1,3-thiazol-5-yl)methyl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-5-yl]ethyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ncsc1CN1Cc2cncn2C(CCNS(C)(=O)=O)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H21N5O2S2.C2HF3O2/c1-11-14(22-10-16-11)8-18-6-12(3-4-17-23(2,20)21)19-9-15-5-13(19)7-18;3-2(4,5)1(6)7/h5,9-10,12,17H,3-4,6-8H2,1-2H3;(H,6,7) |
| InChIKey | RFUKGEBYYOLZSC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |