C22H24F4N4O3 — CID 155839928
1'-[(4-fluorophenyl)methyl]-2,6-dimethylspiro[7H-pyrido[4,3-d]pyrimidine-8,4'-piperidine]-5-one;2,2,2-trifluoroacetic acid (PubChem CID 155839928) has the molecular formula C22H24F4N4O3 and a molecular weight of 468.45 g/mol. Its IUPAC name is 1'-[(4-fluorophenyl)methyl]-2,6-dimethylspiro[7H-pyrido[4,3-d]pyrimidine-8,4'-piperidine]-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | 1'-[(4-fluorophenyl)methyl]-2,6-dimethylspiro[7H-pyrido[4,3-d]pyrimidine-8,4'-piperidine]-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155839928 |
| Molecular Formula | C22H24F4N4O3 |
| Molecular Weight | 468.45 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 1'-[(4-fluorophenyl)methyl]-2,6-dimethylspiro[7H-pyrido[4,3-d]pyrimidine-8,4'-piperidine]-5-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ncc2c(n1)C1(CCN(Cc3ccc(F)cc3)CC1)CN(C)C2=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H23FN4O.C2HF3O2/c1-14-22-11-17-18(23-14)20(13-24(2)19(17)26)7-9-25(10-8-20)12-15-3-5-16(21)6-4-15;3-2(4,5)1(6)7/h3-6,11H,7-10,12-13H2,1-2H3;(H,6,7) |
| InChIKey | PRWKNPBENBZGPK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |