C15H20F6N4O4 — CID 155840115
4-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155840115) has the molecular formula C15H20F6N4O4 and a molecular weight of 434.34 g/mol. Its IUPAC name is 4-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155840115 |
| Molecular Formula | C15H20F6N4O4 |
| Molecular Weight | 434.34 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 4-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cn1cc(CN2CCC3NCCC32)cn1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H18N4.2C2HF3O2/c1-14-7-9(6-13-14)8-15-5-3-10-11(15)2-4-12-10;2*3-2(4,5)1(6)7/h6-7,10-12H,2-5,8H2,1H3;2*(H,6,7) |
| InChIKey | AUHNPBXHPUEEIR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |