C17H29F3N4O5S — CID 155840127
13-ethyl-N,N-dimethyl-4-oxo-3,9,13-triazadispiro[4.0.56.35]tetradecane-9-sulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155840127) has the molecular formula C17H29F3N4O5S and a molecular weight of 458.50 g/mol. Its IUPAC name is 13-ethyl-N,N-dimethyl-4-oxo-3,9,13-triazadispiro[4.0.56.35]tetradecane-9-sulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | 13-ethyl-N,N-dimethyl-4-oxo-3,9,13-triazadispiro[4.0.56.35]tetradecane-9-sulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155840127 |
| Molecular Formula | C17H29F3N4O5S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 13-ethyl-N,N-dimethyl-4-oxo-3,9,13-triazadispiro[4.0.56.35]tetradecane-9-sulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CCN1CC2(CCN(S(=O)(=O)N(C)C)CC2)C2(CCNC2=O)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H28N4O3S.C2HF3O2/c1-4-18-11-14(15(12-18)5-8-16-13(15)20)6-9-19(10-7-14)23(21,22)17(2)3;3-2(4,5)1(6)7/h4-12H2,1-3H3,(H,16,20);(H,6,7) |
| InChIKey | GJDVREJTKRBWHF-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |