C19H23F6N5O6S — CID 155840150
N-(2-methoxyethyl)-2-[4-(1,3-thiazol-2-ylmethyl)morpholin-3-yl]pyrimidin-4-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155840150) has the molecular formula C19H23F6N5O6S and a molecular weight of 563.48 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[4-(1,3-thiazol-2-ylmethyl)morpholin-3-yl]pyrimidin-4-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-(2-methoxyethyl)-2-[4-(1,3-thiazol-2-ylmethyl)morpholin-3-yl]pyrimidin-4-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155840150 |
| Molecular Formula | C19H23F6N5O6S |
| Molecular Weight | 563.48 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | N-(2-methoxyethyl)-2-[4-(1,3-thiazol-2-ylmethyl)morpholin-3-yl]pyrimidin-4-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COCCNc1ccnc(C2COCCN2Cc2nccs2)n1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H21N5O2S.2C2HF3O2/c1-21-7-4-16-13-2-3-18-15(19-13)12-11-22-8-6-20(12)10-14-17-5-9-23-14;2*3-2(4,5)1(6)7/h2-3,5,9,12H,4,6-8,10-11H2,1H3,(H,16,18,19);2*(H,6,7) |
| InChIKey | SFVXZJMHEKIUEK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|