C17H22F3N3O4S — CID 155840170
2-[(2R,3aS,6aS)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-(azetidin-1-yl)ethanone;2,2,2-trifluoroacetic acid (PubChem CID 155840170) has the molecular formula C17H22F3N3O4S and a molecular weight of 421.44 g/mol. Its IUPAC name is 2-[(2R,3aS,6aS)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-(azetidin-1-yl)ethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(2R,3aS,6aS)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-(azetidin-1-yl)ethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155840170 |
| Molecular Formula | C17H22F3N3O4S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 2-[(2R,3aS,6aS)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-(azetidin-1-yl)ethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(C[C@H]1C[C@H]2CN(Cc3nccs3)C[C@H]2O1)N1CCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H21N3O2S.C2HF3O2/c19-15(18-3-1-4-18)7-12-6-11-8-17(9-13(11)20-12)10-14-16-2-5-21-14;3-2(4,5)1(6)7/h2,5,11-13H,1,3-4,6-10H2;(H,6,7)/t11-,12+,13+;/m0./s1 |
| InChIKey | UZOREDRWJWQMNT-LUHWTZLKSA-N |
| XLogP | 1.99 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |