C16H21F3N2O6S2 — CID 155840492
(3R,3aR,6aS)-1-cyclopropylsulfonyl-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155840492) has the molecular formula C16H21F3N2O6S2 and a molecular weight of 458.48 g/mol. Its IUPAC name is (3R,3aR,6aS)-1-cyclopropylsulfonyl-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,3aR,6aS)-1-cyclopropylsulfonyl-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155840492 |
| Molecular Formula | C16H21F3N2O6S2 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | (3R,3aR,6aS)-1-cyclopropylsulfonyl-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CO[C@H]2CN(S(=O)(=O)C3CC3)[C@@H]3COC[C@H]23)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H20N2O4S2.C2HF3O2/c1-9-15-10(8-21-9)5-20-14-4-16(13-7-19-6-12(13)14)22(17,18)11-2-3-11;3-2(4,5)1(6)7/h8,11-14H,2-7H2,1H3;(H,6,7)/t12-,13+,14-;/m0./s1 |
| InChIKey | COWNNEHCICPNDX-VDTKTRGNSA-N |
| XLogP | 1.79 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |